C19H18N6O2S — CID 167101747
1-[2-[4-(2-cyanophenyl)piperazin-1-yl]-2-oxoethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea (PubChem CID 167101747) has the molecular formula C19H18N6O2S and a molecular weight of 394.46 g/mol. Its IUPAC name is 1-[2-[4-(2-cyanophenyl)piperazin-1-yl]-2-oxoethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-[2-[4-(2-cyanophenyl)piperazin-1-yl]-2-oxoethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 167101747 |
| Molecular Formula | C19H18N6O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-[2-[4-(2-cyanophenyl)piperazin-1-yl]-2-oxoethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
| SMILES | C#Cc1nc(NC(=O)NCC(=O)N2CCN(c3ccccc3C#N)CC2)cs1 |
| InChI | InChI=1S/C19H18N6O2S/c1-2-17-22-16(13-28-17)23-19(27)21-12-18(26)25-9-7-24(8-10-25)15-6-4-3-5-14(15)11-20/h1,3-6,13H,7-10,12H2,(H2,21,23,27) |
| InChIKey | ZULLWZBJHXKABE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|