C24H17N5OS2 — CID 169223143
5-(1,3-benzothiazol-7-yl)-2-[4-(2-ethynyl-1,3-thiazole-4-carbonyl)piperazin-1-yl]benzonitrile (PubChem CID 169223143) has the molecular formula C24H17N5OS2 and a molecular weight of 455.57 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-7-yl)-2-[4-(2-ethynyl-1,3-thiazole-4-carbonyl)piperazin-1-yl]benzonitrile.
| Compound Name | 5-(1,3-benzothiazol-7-yl)-2-[4-(2-ethynyl-1,3-thiazole-4-carbonyl)piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 169223143 |
| Molecular Formula | C24H17N5OS2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 5-(1,3-benzothiazol-7-yl)-2-[4-(2-ethynyl-1,3-thiazole-4-carbonyl)piperazin-1-yl]benzonitrile |
| SMILES | C#Cc1nc(C(=O)N2CCN(c3ccc(-c4cccc5ncsc45)cc3C#N)CC2)cs1 |
| InChI | InChI=1S/C24H17N5OS2/c1-2-22-27-20(14-31-22)24(30)29-10-8-28(9-11-29)21-7-6-16(12-17(21)13-25)18-4-3-5-19-23(18)32-15-26-19/h1,3-7,12,14-15H,8-11H2 |
| InChIKey | BYWBMRNQNGATPN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|