C26H23N5O3S — CID 169223205
methyl 4-[4-[4-(2-ethynyl-1,3-thiazole-4-carbonyl)piperazin-1-yl]phenyl]-1-methylindazole-6-carboxylate (PubChem CID 169223205) has the molecular formula C26H23N5O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is methyl 4-[4-[4-(2-ethynyl-1,3-thiazole-4-carbonyl)piperazin-1-yl]phenyl]-1-methylindazole-6-carboxylate.
| Compound Name | methyl 4-[4-[4-(2-ethynyl-1,3-thiazole-4-carbonyl)piperazin-1-yl]phenyl]-1-methylindazole-6-carboxylate |
|---|---|
| PubChem CID | 169223205 |
| Molecular Formula | C26H23N5O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | methyl 4-[4-[4-(2-ethynyl-1,3-thiazole-4-carbonyl)piperazin-1-yl]phenyl]-1-methylindazole-6-carboxylate |
| SMILES | C#Cc1nc(C(=O)N2CCN(c3ccc(-c4cc(C(=O)OC)cc5c4cnn5C)cc3)CC2)cs1 |
| InChI | InChI=1S/C26H23N5O3S/c1-4-24-28-22(16-35-24)25(32)31-11-9-30(10-12-31)19-7-5-17(6-8-19)20-13-18(26(33)34-3)14-23-21(20)15-27-29(23)2/h1,5-8,13-16H,9-12H2,2-3H3 |
| InChIKey | COFCJJKIQGVPTP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|