C18H17N5OS — CID 171401054
1-(2-ethynyl-1,3-thiazol-4-yl)-3-[[4-[(2S)-2-isocyanopyrrolidin-1-yl]phenyl]methyl]urea (PubChem CID 171401054) has the molecular formula C18H17N5OS and a molecular weight of 351.44 g/mol. Its IUPAC name is 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[[4-[(2S)-2-isocyanopyrrolidin-1-yl]phenyl]methyl]urea.
| Compound Name | 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[[4-[(2S)-2-isocyanopyrrolidin-1-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 171401054 |
| Molecular Formula | C18H17N5OS |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[[4-[(2S)-2-isocyanopyrrolidin-1-yl]phenyl]methyl]urea |
| SMILES | [C-]#[N+][C@H]1CCCN1c1ccc(CNC(=O)Nc2csc(C#C)n2)cc1 |
| InChI | InChI=1S/C18H17N5OS/c1-3-17-21-15(12-25-17)22-18(24)20-11-13-6-8-14(9-7-13)23-10-4-5-16(23)19-2/h1,6-9,12,16H,4-5,10-11H2,(H2,20,22,24)/t16-/m1/s1 |
| InChIKey | WWSQXFUIQPGHEL-MRXNPFEDSA-N |
| XLogP | 3.29 |
| TPSA | 61.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|