C26H25ClN2O — CID 118096611
(2R)-1-[4-[2-(4-benzylphenyl)ethynyl]phenyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 118096611) has the molecular formula C26H25ClN2O and a molecular weight of 416.95 g/mol. Its IUPAC name is (2R)-1-[4-[2-(4-benzylphenyl)ethynyl]phenyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2R)-1-[4-[2-(4-benzylphenyl)ethynyl]phenyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 118096611 |
| Molecular Formula | C26H25ClN2O |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (2R)-1-[4-[2-(4-benzylphenyl)ethynyl]phenyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)[C@H]1CCCN1c1ccc(C#Cc2ccc(Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H24N2O.ClH/c27-26(29)25-7-4-18-28(25)24-16-14-21(15-17-24)9-8-20-10-12-23(13-11-20)19-22-5-2-1-3-6-22;/h1-3,5-6,10-17,25H,4,7,18-19H2,(H2,27,29);1H/t25-;/m1./s1 |
| InChIKey | BQJIWWYROIROQP-VQIWEWKSSA-N |
| XLogP | 4.55 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|