C32H40N6O6S4 — CID 89040282
N-[2-benzylsulfanyl-3-(4-methylsulfonylpiperazin-1-yl)propyl]-7-(pyridin-2-ylsulfonylamino)-5-(3-sulfanylpropoxy)-1H-indole-2-carboxamide (PubChem CID 89040282) has the molecular formula C32H40N6O6S4 and a molecular weight of 732.98 g/mol. Its IUPAC name is N-[2-benzylsulfanyl-3-(4-methylsulfonylpiperazin-1-yl)propyl]-7-(pyridin-2-ylsulfonylamino)-5-(3-sulfanylpropoxy)-1H-indole-2-carboxamide.
| Compound Name | N-[2-benzylsulfanyl-3-(4-methylsulfonylpiperazin-1-yl)propyl]-7-(pyridin-2-ylsulfonylamino)-5-(3-sulfanylpropoxy)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 89040282 |
| Molecular Formula | C32H40N6O6S4 |
| Molecular Weight | 732.98 g/mol |
| Exact Mass | 732.19 |
| IUPAC Name | N-[2-benzylsulfanyl-3-(4-methylsulfonylpiperazin-1-yl)propyl]-7-(pyridin-2-ylsulfonylamino)-5-(3-sulfanylpropoxy)-1H-indole-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCN(CC(CNC(=O)c2cc3cc(OCCCS)cc(NS(=O)(=O)c4ccccn4)c3[nH]2)SCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H40N6O6S4/c1-47(40,41)38-14-12-37(13-15-38)22-27(46-23-24-8-3-2-4-9-24)21-34-32(39)29-19-25-18-26(44-16-7-17-45)20-28(31(25)35-29)36-48(42,43)30-10-5-6-11-33-30/h2-6,8-11,18-20,27,35-36,45H,7,12-17,21-23H2,1H3,(H,34,39) |
| InChIKey | IJUMTZZVWIVWAG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 153.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.98 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|