C30H38N4O7S2 — CID 89063213
N-(2-benzylsulfanyl-3,3-dimethoxypropyl)-5-(2-methoxyethoxy)-7-[methyl(pyridin-2-ylsulfonyl)amino]-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 89063213) has the molecular formula C30H38N4O7S2 and a molecular weight of 630.79 g/mol. Its IUPAC name is N-(2-benzylsulfanyl-3,3-dimethoxypropyl)-5-(2-methoxyethoxy)-7-[methyl(pyridin-2-ylsulfonyl)amino]-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(2-benzylsulfanyl-3,3-dimethoxypropyl)-5-(2-methoxyethoxy)-7-[methyl(pyridin-2-ylsulfonyl)amino]-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 89063213 |
| Molecular Formula | C30H38N4O7S2 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | N-(2-benzylsulfanyl-3,3-dimethoxypropyl)-5-(2-methoxyethoxy)-7-[methyl(pyridin-2-ylsulfonyl)amino]-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | COCCOc1cc2c(c(N(C)S(=O)(=O)c3ccccn3)c1)NC(C(=O)NCC(SCc1ccccc1)C(OC)OC)C2 |
| InChI | InChI=1S/C30H38N4O7S2/c1-34(43(36,37)27-12-8-9-13-31-27)25-18-23(41-15-14-38-2)16-22-17-24(33-28(22)25)29(35)32-19-26(30(39-3)40-4)42-20-21-10-6-5-7-11-21/h5-13,16,18,24,26,30,33H,14-15,17,19-20H2,1-4H3,(H,32,35) |
| InChIKey | XIDUEZNBBGKQPC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|