C30H44O3 — CID 89040730
2-[4-(oxan-2-yloxy)phenyl]-1-[4-(4-propylcyclohexyl)cyclohexyl]but-3-yn-2-ol (PubChem CID 89040730) has the molecular formula C30H44O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is 2-[4-(oxan-2-yloxy)phenyl]-1-[4-(4-propylcyclohexyl)cyclohexyl]but-3-yn-2-ol.
| Compound Name | 2-[4-(oxan-2-yloxy)phenyl]-1-[4-(4-propylcyclohexyl)cyclohexyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 89040730 |
| Molecular Formula | C30H44O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | 2-[4-(oxan-2-yloxy)phenyl]-1-[4-(4-propylcyclohexyl)cyclohexyl]but-3-yn-2-ol |
| SMILES | C#CC(O)(CC1CCC(C2CCC(CCC)CC2)CC1)c1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C30H44O3/c1-3-7-23-9-13-25(14-10-23)26-15-11-24(12-16-26)22-30(31,4-2)27-17-19-28(20-18-27)33-29-8-5-6-21-32-29/h2,17-20,23-26,29,31H,3,5-16,21-22H2,1H3 |
| InChIKey | JWJLOZKPWNIYIK-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|