C29H24ClFO3S — CID 89042355
(1S,5S)-3-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-4-phenoxycarbothioyloxybicyclo[3.2.1]oct-3-en-2-one (PubChem CID 89042355) has the molecular formula C29H24ClFO3S and a molecular weight of 507.03 g/mol. Its IUPAC name is (1S,5S)-3-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-4-phenoxycarbothioyloxybicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1S,5S)-3-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-4-phenoxycarbothioyloxybicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 89042355 |
| Molecular Formula | C29H24ClFO3S |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | (1S,5S)-3-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-4-phenoxycarbothioyloxybicyclo[3.2.1]oct-3-en-2-one |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2F)cc1C1=C(OC(=S)Oc2ccccc2)[C@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C29H24ClFO3S/c1-2-17-8-9-18(23-13-12-21(30)16-25(23)31)15-24(17)26-27(32)19-10-11-20(14-19)28(26)34-29(35)33-22-6-4-3-5-7-22/h3-9,12-13,15-16,19-20H,2,10-11,14H2,1H3/t19-,20-/m0/s1 |
| InChIKey | BIPUPHKVAIKPGA-PMACEKPBSA-N |
| XLogP | 7.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|