C32H38N8O — CID 89043883
1-[6-[ethenyl-[(1Z,3Z)-penta-1,3-dienyl]amino]-2-pyridinyl]-2-propan-2-yl-6-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 89043883) has the molecular formula C32H38N8O and a molecular weight of 550.71 g/mol. Its IUPAC name is 1-[6-[ethenyl-[(1Z,3Z)-penta-1,3-dienyl]amino]-2-pyridinyl]-2-propan-2-yl-6-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[6-[ethenyl-[(1Z,3Z)-penta-1,3-dienyl]amino]-2-pyridinyl]-2-propan-2-yl-6-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 89043883 |
| Molecular Formula | C32H38N8O |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | 1-[6-[ethenyl-[(1Z,3Z)-penta-1,3-dienyl]amino]-2-pyridinyl]-2-propan-2-yl-6-[(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CN(/C=C\C=C/C)c1cccc(-n2c3nc(Nc4ccc5c(c4)CN(C)CC5(C)C)ncc3c(=O)n2C(C)C)n1 |
| InChI | InChI=1S/C32H38N8O/c1-8-10-11-17-38(9-2)27-13-12-14-28(35-27)40-29-25(30(41)39(40)22(3)4)19-33-31(36-29)34-24-15-16-26-23(18-24)20-37(7)21-32(26,5)6/h8-19,22H,2,20-21H2,1,3-7H3,(H,33,34,36)/b10-8-,17-11- |
| InChIKey | QOOQPXQJZBGDGD-QUTMMMPJSA-N |
| XLogP | 6.06 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|