About hydroxy-methoxy-phenyl-λ3-iodane
hydroxy-methoxy-phenyl-λ3-iodane (PubChem CID 89044198) has the molecular formula C7H9IO2
and a molecular weight of 252.05 g/mol. Its IUPAC name is hydroxy-methoxy-phenyl-λ3-iodane.
Molecular Properties
| Compound Name | hydroxy-methoxy-phenyl-λ3-iodane |
| PubChem CID | 89044198 |
| Molecular Formula | C7H9IO2 |
| Molecular Weight | 252.05 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | hydroxy-methoxy-phenyl-λ3-iodane |
| SMILES | COI(O)c1ccccc1 |
| InChI | InChI=1S/C7H9IO2/c1-10-8(9)7-5-3-2-4-6-7/h2-6,9H,1H3 |
| InChIKey | FBBUGMWKBPJRCN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.05 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-methoxy-phenyl-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-methoxy-phenyl-λ3-iodane?
The IUPAC name of hydroxy-methoxy-phenyl-λ3-iodane (CID 89044198) is hydroxy-methoxy-phenyl-λ3-iodane.
What is the SMILES notation for hydroxy-methoxy-phenyl-λ3-iodane?
The canonical SMILES for hydroxy-methoxy-phenyl-λ3-iodane is COI(O)c1ccccc1.
What is the InChIKey of hydroxy-methoxy-phenyl-λ3-iodane?
The InChIKey is FBBUGMWKBPJRCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9IO2/c1-10-8(9)7-5-3-2-4-6-7/h2-6,9H,1H3.
What are the key properties of hydroxy-methoxy-phenyl-λ3-iodane?
hydroxy-methoxy-phenyl-λ3-iodane has a molecular weight of 252.05 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-methoxy-phenyl-λ3-iodane is sourced from PubChem (CID 89044198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).