C15H21ClF3N — CID 89045354
4-[4-chloro-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-1-propylpiperidine (PubChem CID 89045354) has the molecular formula C15H21ClF3N and a molecular weight of 307.79 g/mol. Its IUPAC name is 4-[4-chloro-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-1-propylpiperidine.
| Compound Name | 4-[4-chloro-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-1-propylpiperidine |
|---|---|
| PubChem CID | 89045354 |
| Molecular Formula | C15H21ClF3N |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-[4-chloro-5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-1-propylpiperidine |
| SMILES | CCCN1CCC(C2=CCC(Cl)C(C(F)(F)F)=C2)CC1 |
| InChI | InChI=1S/C15H21ClF3N/c1-2-7-20-8-5-11(6-9-20)12-3-4-14(16)13(10-12)15(17,18)19/h3,10-11,14H,2,4-9H2,1H3 |
| InChIKey | QBHXKQURIATKEN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|