C26H42F6O4 — CID 89045555
[1-[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl]cyclohexyl] 2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoate (PubChem CID 89045555) has the molecular formula C26H42F6O4 and a molecular weight of 532.61 g/mol. Its IUPAC name is [1-[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl]cyclohexyl] 2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoate.
| Compound Name | [1-[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl]cyclohexyl] 2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoate |
|---|---|
| PubChem CID | 89045555 |
| Molecular Formula | C26H42F6O4 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | [1-[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl]cyclohexyl] 2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoate |
| SMILES | CCC(C)(C)CC(C)(C(=O)OC1(C(C)C(=O)OC(C(F)(F)F)C(F)(F)F)CCCCC1)C(C)(C)CC |
| InChI | InChI=1S/C26H42F6O4/c1-9-21(4,5)16-23(8,22(6,7)10-2)20(34)36-24(14-12-11-13-15-24)17(3)18(33)35-19(25(27,28)29)26(30,31)32/h17,19H,9-16H2,1-8H3 |
| InChIKey | MQXRETCBPFAXIQ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |