C22H32N6O2 — CID 89045724
amino 1-(2-aminoethyl)-N-[1-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)ethenyl]-6,6-dimethyl-5,7-dihydro-4H-indazole-3-carboximidate (PubChem CID 89045724) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is amino 1-(2-aminoethyl)-N-[1-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)ethenyl]-6,6-dimethyl-5,7-dihydro-4H-indazole-3-carboximidate.
| Compound Name | amino 1-(2-aminoethyl)-N-[1-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)ethenyl]-6,6-dimethyl-5,7-dihydro-4H-indazole-3-carboximidate |
|---|---|
| PubChem CID | 89045724 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | amino 1-(2-aminoethyl)-N-[1-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)ethenyl]-6,6-dimethyl-5,7-dihydro-4H-indazole-3-carboximidate |
| SMILES | C=C(/N=C(/ON)c1nn(CCN)c2c1CCC(C)(C)C2)c1cc(CC)c(=O)[nH]c1C |
| InChI | InChI=1S/C22H32N6O2/c1-6-15-11-17(13(2)25-20(15)29)14(3)26-21(30-24)19-16-7-8-22(4,5)12-18(16)28(27-19)10-9-23/h11H,3,6-10,12,23-24H2,1-2,4-5H3,(H,25,29)/b26-21+ |
| InChIKey | LGSZVPDXUOILFJ-YYADALCUSA-N |
| XLogP | 2.22 |
| TPSA | 124.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|