C22H23BrN2O5 — CID 89048054
methyl (2S)-3-[(2-bromoacetyl)amino]-2-[[4-[(E)-2-[4-(hydroxymethyl)phenyl]ethenyl]benzoyl]amino]propanoate (PubChem CID 89048054) has the molecular formula C22H23BrN2O5 and a molecular weight of 475.34 g/mol. Its IUPAC name is methyl (2S)-3-[(2-bromoacetyl)amino]-2-[[4-[(E)-2-[4-(hydroxymethyl)phenyl]ethenyl]benzoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-[(2-bromoacetyl)amino]-2-[[4-[(E)-2-[4-(hydroxymethyl)phenyl]ethenyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 89048054 |
| Molecular Formula | C22H23BrN2O5 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | methyl (2S)-3-[(2-bromoacetyl)amino]-2-[[4-[(E)-2-[4-(hydroxymethyl)phenyl]ethenyl]benzoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](CNC(=O)CBr)NC(=O)c1ccc(/C=C/c2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C22H23BrN2O5/c1-30-22(29)19(13-24-20(27)12-23)25-21(28)18-10-8-16(9-11-18)3-2-15-4-6-17(14-26)7-5-15/h2-11,19,26H,12-14H2,1H3,(H,24,27)(H,25,28)/b3-2+/t19-/m0/s1 |
| InChIKey | OBEWLDUITOHABC-PHXNAMCJSA-N |
| XLogP | 2.13 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|