C16H12ClF3N2O3 — CID 8905524
[(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 4-chloropyridine-2-carboxylate (PubChem CID 8905524) has the molecular formula C16H12ClF3N2O3 and a molecular weight of 372.73 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 4-chloropyridine-2-carboxylate.
| Compound Name | [(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 4-chloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 8905524 |
| Molecular Formula | C16H12ClF3N2O3 |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | [(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 4-chloropyridine-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc(Cl)ccn1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12ClF3N2O3/c1-9(25-15(24)13-8-11(17)6-7-21-13)14(23)22-12-4-2-10(3-5-12)16(18,19)20/h2-9H,1H3,(H,22,23)/t9-/m0/s1 |
| InChIKey | DCHMEONPGWUTAX-VIFPVBQESA-N |
| XLogP | 3.94 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |