C17H27N3O3 — CID 89060511
3-[[(2-hydroxy-3-pyrrolidin-1-ylpropyl)amino]oxymethyl]-2-methyl-1,4,5,6-tetrahydroindol-7-one (PubChem CID 89060511) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-[[(2-hydroxy-3-pyrrolidin-1-ylpropyl)amino]oxymethyl]-2-methyl-1,4,5,6-tetrahydroindol-7-one.
| Compound Name | 3-[[(2-hydroxy-3-pyrrolidin-1-ylpropyl)amino]oxymethyl]-2-methyl-1,4,5,6-tetrahydroindol-7-one |
|---|---|
| PubChem CID | 89060511 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 3-[[(2-hydroxy-3-pyrrolidin-1-ylpropyl)amino]oxymethyl]-2-methyl-1,4,5,6-tetrahydroindol-7-one |
| SMILES | Cc1[nH]c2c(c1CONCC(O)CN1CCCC1)CCCC2=O |
| InChI | InChI=1S/C17H27N3O3/c1-12-15(14-5-4-6-16(22)17(14)19-12)11-23-18-9-13(21)10-20-7-2-3-8-20/h13,18-19,21H,2-11H2,1H3 |
| InChIKey | ZEFMVISWNHGKOP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|