C4H4BrClN2S — CID 89060823
1-(2-bromo-1,3-thiazol-5-yl)-N-chloromethanamine (PubChem CID 89060823) has the molecular formula C4H4BrClN2S and a molecular weight of 227.51 g/mol. Its IUPAC name is 1-(2-bromo-1,3-thiazol-5-yl)-N-chloromethanamine.
| Compound Name | 1-(2-bromo-1,3-thiazol-5-yl)-N-chloromethanamine |
|---|---|
| PubChem CID | 89060823 |
| Molecular Formula | C4H4BrClN2S |
| Molecular Weight | 227.51 g/mol |
| Exact Mass | 225.90 |
| IUPAC Name | 1-(2-bromo-1,3-thiazol-5-yl)-N-chloromethanamine |
| SMILES | ClNCc1cnc(Br)s1 |
| InChI | InChI=1S/C4H4BrClN2S/c5-4-7-1-3(9-4)2-8-6/h1,8H,2H2 |
| InChIKey | JQGWILWTSYRXQT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|