About N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine
N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine (PubChem CID 126719236) has the molecular formula C7H6ClN3OS
and a molecular weight of 215.67 g/mol. Its IUPAC name is N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine.
Molecular Properties
| Compound Name | N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine |
| PubChem CID | 126719236 |
| Molecular Formula | C7H6ClN3OS |
| Molecular Weight | 215.67 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine |
| SMILES | ClNCc1cnc(-c2ncco2)s1 |
| InChI | InChI=1S/C7H6ClN3OS/c8-11-4-5-3-10-7(13-5)6-9-1-2-12-6/h1-3,11H,4H2 |
| InChIKey | KBZQRBVBUJIMAC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.67 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine?
The IUPAC name of N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine (CID 126719236) is N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine.
What is the SMILES notation for N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine?
The canonical SMILES for N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine is ClNCc1cnc(-c2ncco2)s1.
What is the InChIKey of N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine?
The InChIKey is KBZQRBVBUJIMAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3OS/c8-11-4-5-3-10-7(13-5)6-9-1-2-12-6/h1-3,11H,4H2.
What are the key properties of N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine?
N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine has a molecular weight of 215.67 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine is sourced from PubChem (CID 126719236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).