C7H6ClN3OS — CID 126719236
N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine (PubChem CID 126719236) has the molecular formula C7H6ClN3OS and a molecular weight of 215.67 g/mol. Its IUPAC name is N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine.
| Compound Name | N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 126719236 |
| Molecular Formula | C7H6ClN3OS |
| Molecular Weight | 215.67 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | N-chloro-1-[2-(1,3-oxazol-2-yl)-1,3-thiazol-5-yl]methanamine |
| SMILES | ClNCc1cnc(-c2ncco2)s1 |
| InChI | InChI=1S/C7H6ClN3OS/c8-11-4-5-3-10-7(13-5)6-9-1-2-12-6/h1-3,11H,4H2 |
| InChIKey | KBZQRBVBUJIMAC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.67 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|