C14H27N3O2 — CID 89061387
N-(2,4-dimethylpenta-2,3-dienyl)-3-[2-(2-hydroxyethylamino)ethylamino]propanamide (PubChem CID 89061387) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is N-(2,4-dimethylpenta-2,3-dienyl)-3-[2-(2-hydroxyethylamino)ethylamino]propanamide.
| Compound Name | N-(2,4-dimethylpenta-2,3-dienyl)-3-[2-(2-hydroxyethylamino)ethylamino]propanamide |
|---|---|
| PubChem CID | 89061387 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-(2,4-dimethylpenta-2,3-dienyl)-3-[2-(2-hydroxyethylamino)ethylamino]propanamide |
| SMILES | CC(C)=C=C(C)CNC(=O)CCNCCNCCO |
| InChI | InChI=1S/C14H27N3O2/c1-12(2)10-13(3)11-17-14(19)4-5-15-6-7-16-8-9-18/h15-16,18H,4-9,11H2,1-3H3,(H,17,19) |
| InChIKey | SQVVLUHEZVITOJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|