C23H31BN4O2 — CID 89061498
CID 89061498 (PubChem CID 89061498) has the molecular formula C23H31BN4O2 and a molecular weight of 406.34 g/mol.
| Compound Name | CID 89061498 |
|---|---|
| PubChem CID | 89061498 |
| Molecular Formula | C23H31BN4O2 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | — |
| SMILES | [B]N1CCC[C@H]1COc1cncc(N2CCC(CCOCc3cccnc3)CC2)c1 |
| InChI | InChI=1S/C23H31BN4O2/c24-28-9-2-4-21(28)18-30-23-13-22(15-26-16-23)27-10-5-19(6-11-27)7-12-29-17-20-3-1-8-25-14-20/h1,3,8,13-16,19,21H,2,4-7,9-12,17-18H2/t21-/m0/s1 |
| InChIKey | KXWPUSNRAURUBM-NRFANRHFSA-N |
| XLogP | 3.23 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|