C22H30N6O3S — CID 89062498
1-(3-methylpiperidin-1-yl)ethenyl (2Z)-3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbohydrazonate (PubChem CID 89062498) has the molecular formula C22H30N6O3S and a molecular weight of 458.59 g/mol. Its IUPAC name is 1-(3-methylpiperidin-1-yl)ethenyl (2Z)-3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbohydrazonate.
| Compound Name | 1-(3-methylpiperidin-1-yl)ethenyl (2Z)-3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbohydrazonate |
|---|---|
| PubChem CID | 89062498 |
| Molecular Formula | C22H30N6O3S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 1-(3-methylpiperidin-1-yl)ethenyl (2Z)-3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbohydrazonate |
| SMILES | C=C(O/C(=N\N)c1nc(-c2ccc(S(=O)(=O)C(C)C)cc2)cnc1N)N1CCCC(C)C1 |
| InChI | InChI=1S/C22H30N6O3S/c1-14(2)32(29,30)18-9-7-17(8-10-18)19-12-25-21(23)20(26-19)22(27-24)31-16(4)28-11-5-6-15(3)13-28/h7-10,12,14-15H,4-6,11,13,24H2,1-3H3,(H2,23,25)/b27-22- |
| InChIKey | OWFNTWPIJSJJSQ-QYQHSDTDSA-N |
| XLogP | 2.75 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|