C25H30N6O4S — CID 122648074
[4-[(2-methoxyethylamino)methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboximidate (PubChem CID 122648074) has the molecular formula C25H30N6O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is [4-[(2-methoxyethylamino)methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboximidate.
| Compound Name | [4-[(2-methoxyethylamino)methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboximidate |
|---|---|
| PubChem CID | 122648074 |
| Molecular Formula | C25H30N6O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | [4-[(2-methoxyethylamino)methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccc(CNCCOC)cc1)c1nc(-c2ccc(S(=O)(=O)C(C)C)cc2)cnc1N |
| InChI | InChI=1S/C25H30N6O4S/c1-16(2)36(32,33)20-10-8-18(9-11-20)21-15-30-23(26)22(31-21)25(28)35-24(27)19-6-4-17(5-7-19)14-29-12-13-34-3/h4-11,15-16,27-29H,12-14H2,1-3H3,(H2,26,30)/b27-24+,28-25- |
| InChIKey | UAIUHQSMOVOJRW-BOQRKYGMSA-N |
| XLogP | 3.01 |
| TPSA | 164.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|