C24H29N7O3S — CID 122648020
[4-(methylaminomethyl)benzenecarboximidoyl] 3-amino-6-[4-[2-(dimethylamino)ethylsulfonyl]phenyl]pyrazine-2-carboximidate (PubChem CID 122648020) has the molecular formula C24H29N7O3S and a molecular weight of 495.61 g/mol. Its IUPAC name is [4-(methylaminomethyl)benzenecarboximidoyl] 3-amino-6-[4-[2-(dimethylamino)ethylsulfonyl]phenyl]pyrazine-2-carboximidate.
| Compound Name | [4-(methylaminomethyl)benzenecarboximidoyl] 3-amino-6-[4-[2-(dimethylamino)ethylsulfonyl]phenyl]pyrazine-2-carboximidate |
|---|---|
| PubChem CID | 122648020 |
| Molecular Formula | C24H29N7O3S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | [4-(methylaminomethyl)benzenecarboximidoyl] 3-amino-6-[4-[2-(dimethylamino)ethylsulfonyl]phenyl]pyrazine-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccc(CNC)cc1)c1nc(-c2ccc(S(=O)(=O)CCN(C)C)cc2)cnc1N |
| InChI | InChI=1S/C24H29N7O3S/c1-28-14-16-4-6-18(7-5-16)23(26)34-24(27)21-22(25)29-15-20(30-21)17-8-10-19(11-9-17)35(32,33)13-12-31(2)3/h4-11,15,26-28H,12-14H2,1-3H3,(H2,25,29)/b26-23+,27-24- |
| InChIKey | OBYHKCVMAIKIAS-YZYVWJRPSA-N |
| XLogP | 2.15 |
| TPSA | 158.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|