C26H33N7O3S — CID 122648090
[4-[[2-(dimethylamino)ethylamino]methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboximidate (PubChem CID 122648090) has the molecular formula C26H33N7O3S and a molecular weight of 523.66 g/mol. Its IUPAC name is [4-[[2-(dimethylamino)ethylamino]methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboximidate.
| Compound Name | [4-[[2-(dimethylamino)ethylamino]methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboximidate |
|---|---|
| PubChem CID | 122648090 |
| Molecular Formula | C26H33N7O3S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | [4-[[2-(dimethylamino)ethylamino]methyl]benzenecarboximidoyl] 3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccc(CNCCN(C)C)cc1)c1nc(-c2ccc(S(=O)(=O)C(C)C)cc2)cnc1N |
| InChI | InChI=1S/C26H33N7O3S/c1-17(2)37(34,35)21-11-9-19(10-12-21)22-16-31-24(27)23(32-22)26(29)36-25(28)20-7-5-18(6-8-20)15-30-13-14-33(3)4/h5-12,16-17,28-30H,13-15H2,1-4H3,(H2,27,31)/b28-25+,29-26- |
| InChIKey | ACTMMXPRLGNGKV-MGZNUUIQSA-N |
| XLogP | 2.93 |
| TPSA | 158.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|