C27H32N6O6S — CID 59471855
tert-butyl N-[[4-[[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbonyl]amino]carbamoyl]phenyl]methyl]carbamate (PubChem CID 59471855) has the molecular formula C27H32N6O6S and a molecular weight of 568.66 g/mol. Its IUPAC name is tert-butyl N-[[4-[[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbonyl]amino]carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbonyl]amino]carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59471855 |
| Molecular Formula | C27H32N6O6S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | tert-butyl N-[[4-[[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbonyl]amino]carbamoyl]phenyl]methyl]carbamate |
| SMILES | CC(C)S(=O)(=O)c1ccc(-c2cnc(N)c(C(=O)NNC(=O)c3ccc(CNC(=O)OC(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C27H32N6O6S/c1-16(2)40(37,38)20-12-10-18(11-13-20)21-15-29-23(28)22(31-21)25(35)33-32-24(34)19-8-6-17(7-9-19)14-30-26(36)39-27(3,4)5/h6-13,15-16H,14H2,1-5H3,(H2,28,29)(H,30,36)(H,32,34)(H,33,35) |
| InChIKey | CKULQUMECHWHMF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 182.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|