C29H33N7O6S2 — CID 91292172
benzyl (2R)-2-[[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbonyl]amino]carbamothioylcarbamoyl]piperidine-1-carboxylate (PubChem CID 91292172) has the molecular formula C29H33N7O6S2 and a molecular weight of 639.76 g/mol. Its IUPAC name is benzyl (2R)-2-[[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbonyl]amino]carbamothioylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbonyl]amino]carbamothioylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91292172 |
| Molecular Formula | C29H33N7O6S2 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.19 |
| IUPAC Name | benzyl (2R)-2-[[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carbonyl]amino]carbamothioylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)S(=O)(=O)c1ccc(-c2cnc(N)c(C(=O)NNC(=S)NC(=O)[C@H]3CCCCN3C(=O)OCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C29H33N7O6S2/c1-18(2)44(40,41)21-13-11-20(12-14-21)22-16-31-25(30)24(32-22)27(38)34-35-28(43)33-26(37)23-10-6-7-15-36(23)29(39)42-17-19-8-4-3-5-9-19/h3-5,8-9,11-14,16,18,23H,6-7,10,15,17H2,1-2H3,(H2,30,31)(H,34,38)(H2,33,35,37,43)/t23-/m1/s1 |
| InChIKey | CADLTZPGFKGNPZ-HSZRJFAPSA-N |
| XLogP | 2.73 |
| TPSA | 185.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|