C19H17N5OS — CID 89062449
benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate (PubChem CID 89062449) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate.
| Compound Name | benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate |
|---|---|
| PubChem CID | 89062449 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccccc1)c1nc(-c2ccccc2SC)cnc1N |
| InChI | InChI=1S/C19H17N5OS/c1-26-15-10-6-5-9-13(15)14-11-23-17(20)16(24-14)19(22)25-18(21)12-7-3-2-4-8-12/h2-11,21-22H,1H3,(H2,20,23)/b21-18+,22-19- |
| InChIKey | KEUMUEFGIBLSBL-UWTFAZPUSA-N |
| XLogP | 3.82 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|