About benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate
benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate (PubChem CID 89062449) has the molecular formula C19H17N5OS
and a molecular weight of 363.45 g/mol. Its IUPAC name is benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate.
Molecular Properties
| Compound Name | benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate |
| PubChem CID | 89062449 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccccc1)c1nc(-c2ccccc2SC)cnc1N |
| InChI | InChI=1S/C19H17N5OS/c1-26-15-10-6-5-9-13(15)14-11-23-17(20)16(24-14)19(22)25-18(21)12-7-3-2-4-8-12/h2-11,21-22H,1H3,(H2,20,23)/b21-18+,22-19- |
| InChIKey | KEUMUEFGIBLSBL-UWTFAZPUSA-N |
| XLogP | 3.82 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate?
The IUPAC name of benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate (CID 89062449) is benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate.
What is the SMILES notation for benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate?
The canonical SMILES for benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate is [H]/N=C(\O/C(=N/[H])c1ccccc1)c1nc(-c2ccccc2SC)cnc1N.
What is the InChIKey of benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate?
The InChIKey is KEUMUEFGIBLSBL-UWTFAZPUSA-N. The full InChI is InChI=1S/C19H17N5OS/c1-26-15-10-6-5-9-13(15)14-11-23-17(20)16(24-14)19(22)25-18(21)12-7-3-2-4-8-12/h2-11,21-22H,1H3,(H2,20,23)/b21-18+,22-19-.
What are the key properties of benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate?
benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate has a molecular weight of 363.45 g/mol, XLogP of 3.82, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarboximidoyl 3-amino-6-(2-methylsulfanylphenyl)pyrazine-2-carboximidate is sourced from PubChem (CID 89062449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).