C10H10N2O2 — CID 89063285
4-hydroxy-1,6-dimethyl-1,5-naphthyridin-2-one (PubChem CID 89063285) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 4-hydroxy-1,6-dimethyl-1,5-naphthyridin-2-one.
| Compound Name | 4-hydroxy-1,6-dimethyl-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 89063285 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 4-hydroxy-1,6-dimethyl-1,5-naphthyridin-2-one |
| SMILES | Cc1ccc2c(n1)c(O)cc(=O)n2C |
| InChI | InChI=1S/C10H10N2O2/c1-6-3-4-7-10(11-6)8(13)5-9(14)12(7)2/h3-5,13H,1-2H3 |
| InChIKey | JHLXDQNCSPSULO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |