C11H16N2O4 — CID 89064359
(2R)-2-[[(2S)-2-formamidopent-4-enoyl]amino]pent-4-enoic acid (PubChem CID 89064359) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-formamidopent-4-enoyl]amino]pent-4-enoic acid.
| Compound Name | (2R)-2-[[(2S)-2-formamidopent-4-enoyl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 89064359 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (2R)-2-[[(2S)-2-formamidopent-4-enoyl]amino]pent-4-enoic acid |
| SMILES | C=CC[C@H](NC=O)C(=O)N[C@H](CC=C)C(=O)O |
| InChI | InChI=1S/C11H16N2O4/c1-3-5-8(12-7-14)10(15)13-9(6-4-2)11(16)17/h3-4,7-9H,1-2,5-6H2,(H,12,14)(H,13,15)(H,16,17)/t8-,9+/m0/s1 |
| InChIKey | OHHBBATYUJPOSA-DTWKUNHWSA-N |
| XLogP | -0.18 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|