C13H24N2O6S — CID 20638690
(2S)-2-[[(2S)-2-formamido-4-sulfanylbutanoyl]amino]-6,6-dimethoxyhexanoic acid (PubChem CID 20638690) has the molecular formula C13H24N2O6S and a molecular weight of 336.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-formamido-4-sulfanylbutanoyl]amino]-6,6-dimethoxyhexanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-formamido-4-sulfanylbutanoyl]amino]-6,6-dimethoxyhexanoic acid |
|---|---|
| PubChem CID | 20638690 |
| Molecular Formula | C13H24N2O6S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (2S)-2-[[(2S)-2-formamido-4-sulfanylbutanoyl]amino]-6,6-dimethoxyhexanoic acid |
| SMILES | COC(CCC[C@H](NC(=O)[C@H](CCS)NC=O)C(=O)O)OC |
| InChI | InChI=1S/C13H24N2O6S/c1-20-11(21-2)5-3-4-10(13(18)19)15-12(17)9(6-7-22)14-8-16/h8-11,22H,3-7H2,1-2H3,(H,14,16)(H,15,17)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | QHNXDMUITHHODB-UWVGGRQHSA-N |
| XLogP | -0.22 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|