C23H22N4OS — CID 89066878
N-[3-(2-aminophenyl)sulfanyl-1-(pyridin-2-ylmethyl)indol-6-yl]propanamide (PubChem CID 89066878) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[3-(2-aminophenyl)sulfanyl-1-(pyridin-2-ylmethyl)indol-6-yl]propanamide.
| Compound Name | N-[3-(2-aminophenyl)sulfanyl-1-(pyridin-2-ylmethyl)indol-6-yl]propanamide |
|---|---|
| PubChem CID | 89066878 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[3-(2-aminophenyl)sulfanyl-1-(pyridin-2-ylmethyl)indol-6-yl]propanamide |
| SMILES | CCC(=O)Nc1ccc2c(Sc3ccccc3N)cn(Cc3ccccn3)c2c1 |
| InChI | InChI=1S/C23H22N4OS/c1-2-23(28)26-16-10-11-18-20(13-16)27(14-17-7-5-6-12-25-17)15-22(18)29-21-9-4-3-8-19(21)24/h3-13,15H,2,14,24H2,1H3,(H,26,28) |
| InChIKey | GVRJOBYFRCQXCT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|