C22H15F2N3O4S — CID 154195424
[1-[(3,5-difluorophenyl)methyl]-3-(2-nitrophenyl)sulfanylindol-6-yl]carbamic acid (PubChem CID 154195424) has the molecular formula C22H15F2N3O4S and a molecular weight of 455.44 g/mol. Its IUPAC name is [1-[(3,5-difluorophenyl)methyl]-3-(2-nitrophenyl)sulfanylindol-6-yl]carbamic acid.
| Compound Name | [1-[(3,5-difluorophenyl)methyl]-3-(2-nitrophenyl)sulfanylindol-6-yl]carbamic acid |
|---|---|
| PubChem CID | 154195424 |
| Molecular Formula | C22H15F2N3O4S |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | [1-[(3,5-difluorophenyl)methyl]-3-(2-nitrophenyl)sulfanylindol-6-yl]carbamic acid |
| SMILES | O=C(O)Nc1ccc2c(Sc3ccccc3[N+](=O)[O-])cn(Cc3cc(F)cc(F)c3)c2c1 |
| InChI | InChI=1S/C22H15F2N3O4S/c23-14-7-13(8-15(24)9-14)11-26-12-21(32-20-4-2-1-3-18(20)27(30)31)17-6-5-16(10-19(17)26)25-22(28)29/h1-10,12,25H,11H2,(H,28,29) |
| InChIKey | RGPXRUJHFPEFPR-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|