C24H21F2N3OS — CID 89066687
N-[3-(2-aminophenyl)sulfanyl-1-[(3,5-difluorophenyl)methyl]indol-6-yl]propanamide (PubChem CID 89066687) has the molecular formula C24H21F2N3OS and a molecular weight of 437.52 g/mol. Its IUPAC name is N-[3-(2-aminophenyl)sulfanyl-1-[(3,5-difluorophenyl)methyl]indol-6-yl]propanamide.
| Compound Name | N-[3-(2-aminophenyl)sulfanyl-1-[(3,5-difluorophenyl)methyl]indol-6-yl]propanamide |
|---|---|
| PubChem CID | 89066687 |
| Molecular Formula | C24H21F2N3OS |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[3-(2-aminophenyl)sulfanyl-1-[(3,5-difluorophenyl)methyl]indol-6-yl]propanamide |
| SMILES | CCC(=O)Nc1ccc2c(Sc3ccccc3N)cn(Cc3cc(F)cc(F)c3)c2c1 |
| InChI | InChI=1S/C24H21F2N3OS/c1-2-24(30)28-18-7-8-19-21(12-18)29(13-15-9-16(25)11-17(26)10-15)14-23(19)31-22-6-4-3-5-20(22)27/h3-12,14H,2,13,27H2,1H3,(H,28,30) |
| InChIKey | DXVVYECPBVNPIK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|