C23H20ClF2N3O2S — CID 172755973
1-[(3,5-difluorophenyl)methyl]-N,N-dimethyl-3-(2-nitrophenyl)sulfanylindol-6-amine;hydrochloride (PubChem CID 172755973) has the molecular formula C23H20ClF2N3O2S and a molecular weight of 475.95 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-N,N-dimethyl-3-(2-nitrophenyl)sulfanylindol-6-amine;hydrochloride.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-N,N-dimethyl-3-(2-nitrophenyl)sulfanylindol-6-amine;hydrochloride |
|---|---|
| PubChem CID | 172755973 |
| Molecular Formula | C23H20ClF2N3O2S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-N,N-dimethyl-3-(2-nitrophenyl)sulfanylindol-6-amine;hydrochloride |
| SMILES | CN(C)c1ccc2c(Sc3ccccc3[N+](=O)[O-])cn(Cc3cc(F)cc(F)c3)c2c1.Cl |
| InChI | InChI=1S/C23H19F2N3O2S.ClH/c1-26(2)18-7-8-19-21(12-18)27(13-15-9-16(24)11-17(25)10-15)14-23(19)31-22-6-4-3-5-20(22)28(29)30;/h3-12,14H,13H2,1-2H3;1H |
| InChIKey | LAJRQQDLZONBBF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 51.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|