C23H19F2N3O3S — CID 11633884
2-[[1-[(3,5-difluorophenyl)methyl]-3-(2-nitrophenyl)sulfanylindol-6-yl]amino]ethanol (PubChem CID 11633884) has the molecular formula C23H19F2N3O3S and a molecular weight of 455.49 g/mol. Its IUPAC name is 2-[[1-[(3,5-difluorophenyl)methyl]-3-(2-nitrophenyl)sulfanylindol-6-yl]amino]ethanol.
| Compound Name | 2-[[1-[(3,5-difluorophenyl)methyl]-3-(2-nitrophenyl)sulfanylindol-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 11633884 |
| Molecular Formula | C23H19F2N3O3S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-[[1-[(3,5-difluorophenyl)methyl]-3-(2-nitrophenyl)sulfanylindol-6-yl]amino]ethanol |
| SMILES | O=[N+]([O-])c1ccccc1Sc1cn(Cc2cc(F)cc(F)c2)c2cc(NCCO)ccc12 |
| InChI | InChI=1S/C23H19F2N3O3S/c24-16-9-15(10-17(25)11-16)13-27-14-23(32-22-4-2-1-3-20(22)28(30)31)19-6-5-18(12-21(19)27)26-7-8-29/h1-6,9-12,14,26,29H,7-8,13H2 |
| InChIKey | MQWIOFLGUYHMNX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|