C28H26F3N3O4S — CID 66842448
tert-butyl N-methyl-N-[3-(2-nitrophenyl)sulfanyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-6-yl]carbamate (PubChem CID 66842448) has the molecular formula C28H26F3N3O4S and a molecular weight of 557.59 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[3-(2-nitrophenyl)sulfanyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-6-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[3-(2-nitrophenyl)sulfanyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-6-yl]carbamate |
|---|---|
| PubChem CID | 66842448 |
| Molecular Formula | C28H26F3N3O4S |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | tert-butyl N-methyl-N-[3-(2-nitrophenyl)sulfanyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-6-yl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc2c(Sc3ccccc3[N+](=O)[O-])cn(Cc3cccc(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C28H26F3N3O4S/c1-27(2,3)38-26(35)32(4)20-12-13-21-23(15-20)33(16-18-8-7-9-19(14-18)28(29,30)31)17-25(21)39-24-11-6-5-10-22(24)34(36)37/h5-15,17H,16H2,1-4H3 |
| InChIKey | KVNZAXMBXYYQHX-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 77.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|