C15H26N2O7 — CID 89070602
2-[carboxymethyl-[2-[carboxymethyl(hexanoyl)amino]propyl]amino]acetic acid (PubChem CID 89070602) has the molecular formula C15H26N2O7 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[carboxymethyl(hexanoyl)amino]propyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-[carboxymethyl(hexanoyl)amino]propyl]amino]acetic acid |
|---|---|
| PubChem CID | 89070602 |
| Molecular Formula | C15H26N2O7 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-[carboxymethyl-[2-[carboxymethyl(hexanoyl)amino]propyl]amino]acetic acid |
| SMILES | CCCCCC(=O)N(CC(=O)O)C(C)CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C15H26N2O7/c1-3-4-5-6-12(18)17(10-15(23)24)11(2)7-16(8-13(19)20)9-14(21)22/h11H,3-10H2,1-2H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | LGKOPSOFTLAGOH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|