C16H27NO2 — CID 89073730
N-[(4Z)-3-cyclopentyloxyhepta-4,6-dienyl]-N-methylpropanamide (PubChem CID 89073730) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is N-[(4Z)-3-cyclopentyloxyhepta-4,6-dienyl]-N-methylpropanamide.
| Compound Name | N-[(4Z)-3-cyclopentyloxyhepta-4,6-dienyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 89073730 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-[(4Z)-3-cyclopentyloxyhepta-4,6-dienyl]-N-methylpropanamide |
| SMILES | C=C/C=C\C(CCN(C)C(=O)CC)OC1CCCC1 |
| InChI | InChI=1S/C16H27NO2/c1-4-6-9-15(19-14-10-7-8-11-14)12-13-17(3)16(18)5-2/h4,6,9,14-15H,1,5,7-8,10-13H2,2-3H3/b9-6- |
| InChIKey | VVYZQYRXJKOGEI-TWGQIWQCSA-N |
| XLogP | 3.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|