C21H18F3N2O5S2- — CID 89074268
[1-[1-(benzenesulfonyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] sulfite (PubChem CID 89074268) has the molecular formula C21H18F3N2O5S2- and a molecular weight of 499.51 g/mol. Its IUPAC name is [1-[1-(benzenesulfonyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] sulfite.
| Compound Name | [1-[1-(benzenesulfonyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] sulfite |
|---|---|
| PubChem CID | 89074268 |
| Molecular Formula | C21H18F3N2O5S2- |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | [1-[1-(benzenesulfonyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] sulfite |
| SMILES | O=S([O-])OC(=CC1CCCC1)c1cc2cc(C(F)(F)F)cnc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H19F3N2O5S2/c22-21(23,24)16-11-15-12-18(19(31-32(27)28)10-14-6-4-5-7-14)26(20(15)25-13-16)33(29,30)17-8-2-1-3-9-17/h1-3,8-14H,4-7H2,(H,27,28)/p-1 |
| InChIKey | JFVSLQVKUWITNO-UHFFFAOYSA-M |
| XLogP | 4.63 |
| TPSA | 101.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|