C27H26N2O7S2 — CID 86654496
methyl 1-(benzenesulfonyl)-2-[3-methyl-1-(4-methylphenyl)sulfonyloxybut-1-enyl]pyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 86654496) has the molecular formula C27H26N2O7S2 and a molecular weight of 554.65 g/mol. Its IUPAC name is methyl 1-(benzenesulfonyl)-2-[3-methyl-1-(4-methylphenyl)sulfonyloxybut-1-enyl]pyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | methyl 1-(benzenesulfonyl)-2-[3-methyl-1-(4-methylphenyl)sulfonyloxybut-1-enyl]pyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 86654496 |
| Molecular Formula | C27H26N2O7S2 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | methyl 1-(benzenesulfonyl)-2-[3-methyl-1-(4-methylphenyl)sulfonyloxybut-1-enyl]pyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)cc(C(=CC(C)C)OS(=O)(=O)c1ccc(C)cc1)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O7S2/c1-18(2)14-25(36-38(33,34)23-12-10-19(3)11-13-23)24-16-20-15-21(27(30)35-4)17-28-26(20)29(24)37(31,32)22-8-6-5-7-9-22/h5-18H,1-4H3 |
| InChIKey | JIELMMKBEFXOAA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 121.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|