C32H35N3O7S2 — CID 86654515
[1-[1-(benzenesulfonyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] 4-methylbenzenesulfonate (PubChem CID 86654515) has the molecular formula C32H35N3O7S2 and a molecular weight of 637.78 g/mol. Its IUPAC name is [1-[1-(benzenesulfonyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] 4-methylbenzenesulfonate.
| Compound Name | [1-[1-(benzenesulfonyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86654515 |
| Molecular Formula | C32H35N3O7S2 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | [1-[1-(benzenesulfonyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=CC2CCCC2)c2cc3cc(NC(=O)OC(C)(C)C)cnc3n2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H35N3O7S2/c1-22-14-16-27(17-15-22)44(39,40)42-29(18-23-10-8-9-11-23)28-20-24-19-25(34-31(36)41-32(2,3)4)21-33-30(24)35(28)43(37,38)26-12-6-5-7-13-26/h5-7,12-21,23H,8-11H2,1-4H3,(H,34,36) |
| InChIKey | GDBZCKRJKVJJOE-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|