C27H26N2O5S2 — CID 86654505
[1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] 4-methylbenzenesulfonate (PubChem CID 86654505) has the molecular formula C27H26N2O5S2 and a molecular weight of 522.65 g/mol. Its IUPAC name is [1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] 4-methylbenzenesulfonate.
| Compound Name | [1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86654505 |
| Molecular Formula | C27H26N2O5S2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | [1-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]-2-cyclopentylethenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=CC2CCCC2)c2cc3cccnc3n2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O5S2/c1-20-13-15-24(16-14-20)36(32,33)34-26(18-21-8-5-6-9-21)25-19-22-10-7-17-28-27(22)29(25)35(30,31)23-11-3-2-4-12-23/h2-4,7,10-19,21H,5-6,8-9H2,1H3 |
| InChIKey | ZHIBYIOKYDBLQS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|