C26H22N2O3S — CID 53486944
1-[4-[2-[1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]ethynyl]phenyl]cyclobutan-1-ol (PubChem CID 53486944) has the molecular formula C26H22N2O3S and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-[4-[2-[1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]ethynyl]phenyl]cyclobutan-1-ol.
| Compound Name | 1-[4-[2-[1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]ethynyl]phenyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 53486944 |
| Molecular Formula | C26H22N2O3S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[4-[2-[1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]ethynyl]phenyl]cyclobutan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C#Cc3ccc(C4(O)CCC4)cc3)cc3cccnc32)cc1 |
| InChI | InChI=1S/C26H22N2O3S/c1-19-5-13-24(14-6-19)32(30,31)28-23(18-21-4-2-17-27-25(21)28)12-9-20-7-10-22(11-8-20)26(29)15-3-16-26/h2,4-8,10-11,13-14,17-18,29H,3,15-16H2,1H3 |
| InChIKey | LKGUTLQMVHQMEG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|