C30H30O14 — CID 89075920
[(3R)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxy-2-methylheptyl] 3,4,5-trihydroxybenzoate (PubChem CID 89075920) has the molecular formula C30H30O14 and a molecular weight of 614.56 g/mol. Its IUPAC name is [(3R)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxy-2-methylheptyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(3R)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxy-2-methylheptyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 89075920 |
| Molecular Formula | C30H30O14 |
| Molecular Weight | 614.56 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | [(3R)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxy-2-methylheptyl] 3,4,5-trihydroxybenzoate |
| SMILES | CC(Oc1c(-c2ccc(O)cc2)oc2cc(O)cc(O)c2c1=O)C(O)C(O)[C@H](O)C(C)COC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C30H30O14/c1-12(11-42-30(41)15-7-19(34)25(38)20(35)8-15)23(36)27(40)24(37)13(2)43-29-26(39)22-18(33)9-17(32)10-21(22)44-28(29)14-3-5-16(31)6-4-14/h3-10,12-13,23-24,27,31-38,40H,11H2,1-2H3/t12?,13?,23-,24?,27?/m1/s1 |
| InChIKey | COZZLPROXRUYQB-NDMUGCAHSA-N |
| XLogP | 2.04 |
| TPSA | 247.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|