C21H18O12 — CID 87188958
[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl] (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate (PubChem CID 87188958) has the molecular formula C21H18O12 and a molecular weight of 462.36 g/mol. Its IUPAC name is [5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl] (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate.
| Compound Name | [5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl] (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
|---|---|
| PubChem CID | 87188958 |
| Molecular Formula | C21H18O12 |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | [5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl] (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)Oc1c(-c2ccc(O)cc2)oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C21H18O12/c22-7-12(26)15(27)17(29)18(30)21(31)33-20-16(28)14-11(25)5-10(24)6-13(14)32-19(20)8-1-3-9(23)4-2-8/h1-7,12,15,17-18,23-27,29-30H/t12-,15+,17-,18-/m0/s1 |
| InChIKey | IUUHBFURQCIPBG-FXBSTXGRSA-N |
| XLogP | -0.88 |
| TPSA | 215.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|