C24H31ClN4O3 — CID 89078591
1-[2-[2-(chloroamino)propanoylamino]-3-methylbutanoyl]-N-(naphthalen-1-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 89078591) has the molecular formula C24H31ClN4O3 and a molecular weight of 458.99 g/mol. Its IUPAC name is 1-[2-[2-(chloroamino)propanoylamino]-3-methylbutanoyl]-N-(naphthalen-1-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[2-(chloroamino)propanoylamino]-3-methylbutanoyl]-N-(naphthalen-1-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89078591 |
| Molecular Formula | C24H31ClN4O3 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 1-[2-[2-(chloroamino)propanoylamino]-3-methylbutanoyl]-N-(naphthalen-1-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | CC(NCl)C(=O)NC(C(=O)N1CCCC1C(=O)NCc1cccc2ccccc12)C(C)C |
| InChI | InChI=1S/C24H31ClN4O3/c1-15(2)21(27-22(30)16(3)28-25)24(32)29-13-7-12-20(29)23(31)26-14-18-10-6-9-17-8-4-5-11-19(17)18/h4-6,8-11,15-16,20-21,28H,7,12-14H2,1-3H3,(H,26,31)(H,27,30) |
| InChIKey | NEIHHTAYQVVZRB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|