C37H54ClN5O3 — CID 89081711
N-(2-amino-2-iminoethyl)-4-[1-[8-tert-butyl-2-(3-chloro-4-propan-2-yloxyphenyl)-3-oxo-1,4-diazaspiro[4.5]decan-4-yl]-4,4-dimethylpentyl]benzamide (PubChem CID 89081711) has the molecular formula C37H54ClN5O3 and a molecular weight of 652.32 g/mol. Its IUPAC name is N-(2-amino-2-iminoethyl)-4-[1-[8-tert-butyl-2-(3-chloro-4-propan-2-yloxyphenyl)-3-oxo-1,4-diazaspiro[4.5]decan-4-yl]-4,4-dimethylpentyl]benzamide.
| Compound Name | N-(2-amino-2-iminoethyl)-4-[1-[8-tert-butyl-2-(3-chloro-4-propan-2-yloxyphenyl)-3-oxo-1,4-diazaspiro[4.5]decan-4-yl]-4,4-dimethylpentyl]benzamide |
|---|---|
| PubChem CID | 89081711 |
| Molecular Formula | C37H54ClN5O3 |
| Molecular Weight | 652.32 g/mol |
| Exact Mass | 651.39 |
| IUPAC Name | N-(2-amino-2-iminoethyl)-4-[1-[8-tert-butyl-2-(3-chloro-4-propan-2-yloxyphenyl)-3-oxo-1,4-diazaspiro[4.5]decan-4-yl]-4,4-dimethylpentyl]benzamide |
| SMILES | [H]/N=C(\N)CNC(=O)c1ccc(C(CCC(C)(C)C)N2C(=O)C(c3ccc(OC(C)C)c(Cl)c3)NC23CCC(C(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C37H54ClN5O3/c1-23(2)46-30-14-13-26(21-28(30)38)32-34(45)43(37(42-32)19-15-27(16-20-37)36(6,7)8)29(17-18-35(3,4)5)24-9-11-25(12-10-24)33(44)41-22-31(39)40/h9-14,21,23,27,29,32,42H,15-20,22H2,1-8H3,(H3,39,40)(H,41,44) |
| InChIKey | LBFZLGSKAYIOPG-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.32 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|