C30H31ClN6O3 — CID 89081735
N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[(R)-[4-(3-chloro-4-phenylmethoxyphenyl)-2-methyl-5-oxo-2H-imidazol-1-yl]-cyclopropylmethyl]benzamide (PubChem CID 89081735) has the molecular formula C30H31ClN6O3 and a molecular weight of 559.07 g/mol. Its IUPAC name is N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[(R)-[4-(3-chloro-4-phenylmethoxyphenyl)-2-methyl-5-oxo-2H-imidazol-1-yl]-cyclopropylmethyl]benzamide.
| Compound Name | N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[(R)-[4-(3-chloro-4-phenylmethoxyphenyl)-2-methyl-5-oxo-2H-imidazol-1-yl]-cyclopropylmethyl]benzamide |
|---|---|
| PubChem CID | 89081735 |
| Molecular Formula | C30H31ClN6O3 |
| Molecular Weight | 559.07 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | N-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-[(R)-[4-(3-chloro-4-phenylmethoxyphenyl)-2-methyl-5-oxo-2H-imidazol-1-yl]-cyclopropylmethyl]benzamide |
| SMILES | CC1N=C(c2ccc(OCc3ccccc3)c(Cl)c2)C(=O)N1[C@@H](c1ccc(C(=O)NC/C(N)=N/N)cc1)C1CC1 |
| InChI | InChI=1S/C30H31ClN6O3/c1-18-35-27(23-13-14-25(24(31)15-23)40-17-19-5-3-2-4-6-19)30(39)37(18)28(20-7-8-20)21-9-11-22(12-10-21)29(38)34-16-26(32)36-33/h2-6,9-15,18,20,28H,7-8,16-17,33H2,1H3,(H2,32,36)(H,34,38)/t18?,28-/m1/s1 |
| InChIKey | BOQATLVCSIZOLM-VZPMCMERSA-N |
| XLogP | 4.01 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.07 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|