C31H40ClN5O2 — CID 89081779
N-(2-amino-2-iminoethyl)-4-[[4-(2-chlorophenyl)-5-oxo-2-(2,3,4,4-tetramethylpentyl)-2H-imidazol-1-yl]-cyclopropylmethyl]benzamide (PubChem CID 89081779) has the molecular formula C31H40ClN5O2 and a molecular weight of 550.15 g/mol. Its IUPAC name is N-(2-amino-2-iminoethyl)-4-[[4-(2-chlorophenyl)-5-oxo-2-(2,3,4,4-tetramethylpentyl)-2H-imidazol-1-yl]-cyclopropylmethyl]benzamide.
| Compound Name | N-(2-amino-2-iminoethyl)-4-[[4-(2-chlorophenyl)-5-oxo-2-(2,3,4,4-tetramethylpentyl)-2H-imidazol-1-yl]-cyclopropylmethyl]benzamide |
|---|---|
| PubChem CID | 89081779 |
| Molecular Formula | C31H40ClN5O2 |
| Molecular Weight | 550.15 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | N-(2-amino-2-iminoethyl)-4-[[4-(2-chlorophenyl)-5-oxo-2-(2,3,4,4-tetramethylpentyl)-2H-imidazol-1-yl]-cyclopropylmethyl]benzamide |
| SMILES | [H]/N=C(\N)CNC(=O)c1ccc(C(C2CC2)N2C(=O)C(c3ccccc3Cl)=NC2CC(C)C(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H40ClN5O2/c1-18(19(2)31(3,4)5)16-26-36-27(23-8-6-7-9-24(23)32)30(39)37(26)28(20-10-11-20)21-12-14-22(15-13-21)29(38)35-17-25(33)34/h6-9,12-15,18-20,26,28H,10-11,16-17H2,1-5H3,(H3,33,34)(H,35,38) |
| InChIKey | ASFBUWRHDHTVMN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.15 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|